[(2R,3S,4R,5R,6R)-3,4-diacetyloxy-6-prop-2-enoxy-5-[(2,2,2-trichloroacetyl)amino]oxan-2-yl]methyl acetate

m 172

Formula: C17H22Cl3NO9

Canonical Smiles: C=CCO[C@@H]1O[C@H](COC(=O)C)[C@H]([C@@H]([C@H]1NC(=O)C(Cl)(Cl)Cl)OC(=O)C)OC(=O)C

Inchi: InChI=1S/C17H22Cl3NO9/c1-5-6-26-15-12(21-16(25)17(18,19)20)14(29-10(4)24)13(28-9(3)23)11(30-15)7-27-8(2)22/h5,11-15H,1,6-7H2,2-4H3,(H,21,25)/t11-,12-,13-,14-,15-/m1/s1


Mass: 489.04

Crosslinks: Pubchem

Publication (over 3 years ago)


Benjamin Goerling


Karlsruhe Institute of Technology, Institute of Organic Chemistry (Stefan Bräse Group)



Thumb 1d13c dept90



Thumb 1d13c dept135



Publication (over 3 years ago)


Benjamin Goerling


Karlsruhe Institute of Technology, Institute of Organic Chemistry (Stefan Bräse Group)





6.73 (d, 1H, 3J = 8.7 Hz, NH), 5.84 (dddd, 1H, 3Jtrans = 17.0 Hz, 3Jcis = 10.6 Hz, 3J = 6.3 Hz, 3J = 5.7 Hz, CH2CH=CH2), 5.34 (dd, 1H, 3J = 10.7 Hz, 3J = 9.3 Hz, 3-H), 5.23 (dq, 1H, 3Jtrans = 17.2 Hz, 2J  and 4J = 1.6 Hz, CH2CH=CHcisHtrans), 5.21 (dq, 1H, 3Jcis = 10.4 Hz, 2J  and 4J = 1.6 Hz, CH2CH=CHcisHtrans), 5.13 (dd, 1H, 3J = 9.7 Hz, 3J = 9.5 Hz, 4-H), 4.72 (d, 1H, 3J = 8.3 Hz, 1-H), 4.36 (ddt, 1H, 2J = 13.0 Hz, 3J = 5.0 Hz, 4J = 1.5 Hz, CHaHbCH=CH2), 4.29 (dd, 1H, 2J = 12.3 Hz, 3J = 4.8 Hz, 6a-H), 4.16 (dd, 1H, 2J = 12.3 Hz, 3J = 2.4 Hz, 6b-H), 4.09 (ddt, 1H, 2J = 13.0 Hz, 3J = 6.4 Hz, 4J = 1.3 Hz, CHaHbCH=CH2), 3.97 (dt, 1H, 3J = 10.7 Hz, 3J = 8.5 Hz, 2-H), 3.72 (ddd, 1H, 3J = 9.9 Hz, 3J = 4.7 Hz, 3J = 2.5 Hz, 5-H), 2.10 (s, 3H, CH3CO), 2.04 (s, 3H, CH3CO), 2.03 (s, 3H, CH3CO)


Thumb 1d13c


= 170.8 (Cquart,  CO), 170.7 (Cquart,  CO), 169.3 (Cquart,  CO), 161.9 (Cquart,  CTCAO), 133.1 (+, CH2CH=CH2), 118.2 (–, CH2CH=CH2), 99.3 (+,  CH), 92.2 (Cquart,  CCl3), 72.0 (+,  CH), 71.4 (+, CH), 70.3 (–,  CH2CH=CH2), 68.3 (+,  CH), 62.0 (–, CH2, C-6), 56.1 (+,  CH), 20.7 (+,  CH3CO), 20.6 (+, CH3CO), 20.5 (+,  CH3CO)




3290 (w), 1743 (m), 1693 (m), 1213 (s) 1032 (s)


Thumb uv vis


209 (0.56)

